Products 1630907-01-5
CAS 1630907-01-5 appears in our catalog under these names: 3-Ethenylazetidine trifluoroacetate, 95%, 3-Ethenylazetidine, trifluoroacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
3-ethenylazetidine;2,2,2-trifluoroacetic acid (CAS 1630907-01-5) is a chemical compound with the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. IUPAC name: 3-ethenylazetidine;2,2,2-trifluoroacetic acid. InChIKey: UAOFRSAKFCIDNF-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO2 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 3-ethenylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | UAOFRSAKFCIDNF-UHFFFAOYSA-N |
| SMILES | C=CC1CNC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
3-ethenylazetidine; trifluoroacetic acid, 3-Vinylazetidine 2,2,2-trifluoroacetate, 3-Ethenylazetidine trifluoroacetate, 3-ethenylazetidine;2,2,2-trifluoroacetic acid, 3-Vinylazetidine2,2,2-trifluoroacetate, 3-Ethenylazetidine trifluoroacetic acid salt, 3-Vinylazetidine Trifluoroacetate, 3-ethenylazetidine; trifluoroacetic acid, 2,2,2-trifluoroacetic acid;3-vinylazetidine