CAS 73193-62-1 appears in our catalog under these names: 2,2,2-Trifluoro-1-(3-hydroxypiperidin-1-yl)ethan-1-one (>90%), 2,2,2-Trifluoro-1-(3-hydroxypiperidin-1-yl)ethanone, 96%. Offered by: TRC, Combi-blocks. Available pack sizes: 100mg, 1g, 500mg, 5g.
2,2,2-trifluoro-1-(3-hydroxypiperidin-1-yl)ethanone (CAS 73193-62-1) is a chemical compound with the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-hydroxypiperidin-1-yl)ethanone. InChIKey: PBTYRDMHPNDRSR-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO2 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-hydroxypiperidin-1-yl)ethanone |
| InChIKey | PBTYRDMHPNDRSR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)