CAS 1369768-29-5 is the registry number for ((1S,2R)-2-(3-Fluorophenyl)-2-(hydroxymethyl)cyclopropyl)methyl acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2S)-2-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl acetate (CAS 1369768-29-5) is a chemical compound with the molecular formula C13H15FO3 and a molecular weight of 238.25 g/mol. IUPAC name: [(1R,2S)-2-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl acetate. InChIKey: VXNBTSLXRMFPQE-WCQYABFASA-N.
| Molecular formula | C13H15FO3 |
|---|---|
| Molecular weight | 238.25 g/mol |
| IUPAC name | [(1R,2S)-2-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl acetate |
| InChIKey | VXNBTSLXRMFPQE-WCQYABFASA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@@]1(CO)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)