Products 474945-57-8

CAS 474945-57-8 is the registry number for 3,3-Dimethyl-2-oxobutyl 2-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(3,3-dimethyl-2-oxobutyl) 2-fluorobenzoate (CAS 474945-57-8) is a chemical compound with the molecular formula C13H15FO3 and a molecular weight of 238.25 g/mol. IUPAC name: (3,3-dimethyl-2-oxobutyl) 2-fluorobenzoate. InChIKey: UJYJQOOOUWLZPW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15FO3
Molecular weight238.25 g/mol
IUPAC name(3,3-dimethyl-2-oxobutyl) 2-fluorobenzoate
InChIKeyUJYJQOOOUWLZPW-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)COC(=O)C1=CC=CC=C1F

Computed by PubChem (NCBI)