Products 1439899-08-7

CAS 1439899-08-7 is the registry number for 2-(4-(3-Fluorophenyl)tetrahydro-2H-pyran-4-yl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-(3-fluorophenyl)oxan-4-yl]acetic acid (CAS 1439899-08-7) is a chemical compound with the molecular formula C13H15FO3 and a molecular weight of 238.25 g/mol. IUPAC name: 2-[4-(3-fluorophenyl)oxan-4-yl]acetic acid. InChIKey: NVOVDPKGTJJYTP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15FO3
Molecular weight238.25 g/mol
IUPAC name2-[4-(3-fluorophenyl)oxan-4-yl]acetic acid
InChIKeyNVOVDPKGTJJYTP-UHFFFAOYSA-N
SMILESC1COCCC1(CC(=O)O)C2=CC(=CC=C2)F

Computed by PubChem (NCBI)