Products 1443306-85-1

CAS 1443306-85-1 is the registry number for Ezetimibe Impurity 96. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-(4-fluorophenyl)-3-methyl-5-oxopentanoate (CAS 1443306-85-1) is a chemical compound with the molecular formula C13H15FO3 and a molecular weight of 238.25 g/mol. IUPAC name: methyl 5-(4-fluorophenyl)-3-methyl-5-oxopentanoate. InChIKey: JULGJUBDLVCIHG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15FO3
Molecular weight238.25 g/mol
IUPAC namemethyl 5-(4-fluorophenyl)-3-methyl-5-oxopentanoate
InChIKeyJULGJUBDLVCIHG-UHFFFAOYSA-N
SMILESCC(CC(=O)C1=CC=C(C=C1)F)CC(=O)OC

Computed by PubChem (NCBI)