Products 1369847-24-4
CAS 1369847-24-4 is the registry number for 1-Methoxy-2-nitro-3-(propan-2-yloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-methoxy-2-nitro-3-propan-2-yloxybenzene (CAS 1369847-24-4) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 1-methoxy-2-nitro-3-propan-2-yloxybenzene. InChIKey: ZLTLCUWEBIXRDR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-methoxy-2-nitro-3-propan-2-yloxybenzene |
| InChIKey | ZLTLCUWEBIXRDR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1[N+](=O)[O-])OC |
Computed by PubChem (NCBI)