Products 1369959-47-6
CAS 1369959-47-6 is the registry number for Sinopodophylline B. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one (CAS 1369959-47-6) is a chemical compound with the molecular formula C21H20O7 and a molecular weight of 384.4 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: VUWRPEGSZKAYCY-UHFFFAOYSA-N.
| Molecular formula | C21H20O7 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | VUWRPEGSZKAYCY-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)OC)C |
Computed by PubChem (NCBI)