Products 137018-54-3
CAS 137018-54-3 is the registry number for Okicenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,6,9-trihydroxy-8-methyl-3,4-dihydro-2H-anthracen-1-one (CAS 137018-54-3) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4,6,9-trihydroxy-8-methyl-3,4-dihydro-2H-anthracen-1-one. InChIKey: LIETVYHJBSLSSW-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4,6,9-trihydroxy-8-methyl-3,4-dihydro-2H-anthracen-1-one |
| InChIKey | LIETVYHJBSLSSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=CC3=C(C(=O)CCC3O)C(=C12)O)O |
Computed by PubChem (NCBI)