CAS 1370411-38-3 is the registry number for 4,4′-Dimethoxybiphenyl-2-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-methoxy-2-(4-methoxyphenyl)benzamide (CAS 1370411-38-3) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 5-methoxy-2-(4-methoxyphenyl)benzamide. InChIKey: NXAKJZWLOTWIRW-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 5-methoxy-2-(4-methoxyphenyl)benzamide |
| InChIKey | NXAKJZWLOTWIRW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=C(C=C2)OC)C(=O)N |
Computed by PubChem (NCBI)