CAS 13720-44-0 is the registry number for 1-Fluoro-5-nitronaphthalene, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1-fluoro-5-nitronaphthalene (CAS 13720-44-0) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 1-fluoro-5-nitronaphthalene. InChIKey: UTIRKPWIJBXLEC-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-fluoro-5-nitronaphthalene |
| InChIKey | UTIRKPWIJBXLEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2F)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)