Products 1372653-45-6
CAS 1372653-45-6 is the registry number for methyl (2R,4R)-4-(trifluoromethyl)pyrrolidine-2-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (2R,4R)-4-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride (CAS 1372653-45-6) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: methyl (2R,4R)-4-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride. InChIKey: RVYOWIHHHSZCRT-TYSVMGFPSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | methyl (2R,4R)-4-(trifluoromethyl)pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | RVYOWIHHHSZCRT-TYSVMGFPSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](CN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)