Products 1373043-42-5
CAS 1373043-42-5 is the registry number for 3-(1-Ethyl-4-pyrazolyl)phenylboronic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
[3-(1-ethylpyrazol-4-yl)phenyl]boronic acid (CAS 1373043-42-5) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: [3-(1-ethylpyrazol-4-yl)phenyl]boronic acid. InChIKey: NDIUKLUWSQGXMO-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | [3-(1-ethylpyrazol-4-yl)phenyl]boronic acid |
| InChIKey | NDIUKLUWSQGXMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CN(N=C2)CC)(O)O |
Computed by PubChem (NCBI)