Products 1373221-30-7
CAS 1373221-30-7 is the registry number for 3-(2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-yl)piperazin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,2-dimethyl-3H-1-benzofuran-7-yl)piperazin-2-one (CAS 1373221-30-7) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: 3-(2,2-dimethyl-3H-1-benzofuran-7-yl)piperazin-2-one. InChIKey: SDEGRPDSSICEQU-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 3-(2,2-dimethyl-3H-1-benzofuran-7-yl)piperazin-2-one |
| InChIKey | SDEGRPDSSICEQU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)C3C(=O)NCCN3)C |
Computed by PubChem (NCBI)