CAS 1373232-62-2 is the registry number for 2-Nitro-5-(trifluoromethoxy)benzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-nitro-5-(trifluoromethoxy)benzamide (CAS 1373232-62-2) is a chemical compound with the molecular formula C8H5F3N2O4 and a molecular weight of 250.13 g/mol. IUPAC name: 2-nitro-5-(trifluoromethoxy)benzamide. InChIKey: ITKYUXUOGDHERZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O4 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethoxy)benzamide |
| InChIKey | ITKYUXUOGDHERZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)