Products 22227-60-7

CAS 22227-60-7 is the registry number for 2-Amino-3-nitro-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-nitro-5-(trifluoromethyl)benzoic acid (CAS 22227-60-7) is a chemical compound with the molecular formula C8H5F3N2O4 and a molecular weight of 250.13 g/mol. IUPAC name: 2-amino-3-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: GGLXUJWJTSSOIL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3N2O4
Molecular weight250.13 g/mol
IUPAC name2-amino-3-nitro-5-(trifluoromethyl)benzoic acid
InChIKeyGGLXUJWJTSSOIL-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)N)[N+](=O)[O-])C(F)(F)F

Computed by PubChem (NCBI)