CAS 1400644-23-6 is the registry number for 3,5-Dinitro-2-methylbenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methyl-1,5-dinitro-3-(trifluoromethyl)benzene (CAS 1400644-23-6) is a chemical compound with the molecular formula C8H5F3N2O4 and a molecular weight of 250.13 g/mol. IUPAC name: 2-methyl-1,5-dinitro-3-(trifluoromethyl)benzene. InChIKey: LXOMTLHUSOHRMK-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O4 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 2-methyl-1,5-dinitro-3-(trifluoromethyl)benzene |
| InChIKey | LXOMTLHUSOHRMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)