Products 2701969-16-4

CAS 2701969-16-4 is the registry number for 3-Amino-4-nitro-2-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-amino-4-nitro-2-(trifluoromethyl)benzoic acid (CAS 2701969-16-4) is a chemical compound with the molecular formula C8H5F3N2O4 and a molecular weight of 250.13 g/mol. IUPAC name: 3-amino-4-nitro-2-(trifluoromethyl)benzoic acid. InChIKey: LGABFDXYAPMEBO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3N2O4
Molecular weight250.13 g/mol
IUPAC name3-amino-4-nitro-2-(trifluoromethyl)benzoic acid
InChIKeyLGABFDXYAPMEBO-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)C(F)(F)F)N)[N+](=O)[O-]

Computed by PubChem (NCBI)