CAS 1373233-02-3 is the registry number for 1,3-Dimethyl 2-(3-amino-5-chloropyridin-2-yl)propanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Dimethyl 2-(3-amino-5-chloro-2-pyridinyl)propanedioate (CAS 1373233-02-3) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: dimethyl 2-(3-amino-5-chloro-2-pyridinyl)propanedioate. InChIKey: DKEWAMRUBCMPHF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | dimethyl 2-(3-amino-5-chloro-2-pyridinyl)propanedioate |
| InChIKey | DKEWAMRUBCMPHF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=N1)Cl)N)C(=O)OC |
Computed by PubChem (NCBI)