Products 1467993-54-9
CAS 1467993-54-9 is the registry number for 4-(4-Chloro-1H-pyrrole-2-carbonyl)morpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-chloro-1H-pyrrole-2-carbonyl)morpholine-3-carboxylic acid (CAS 1467993-54-9) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: 4-(4-chloro-1H-pyrrole-2-carbonyl)morpholine-3-carboxylic acid. InChIKey: OGRYBTDUOPPAGO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | 4-(4-chloro-1H-pyrrole-2-carbonyl)morpholine-3-carboxylic acid |
| InChIKey | OGRYBTDUOPPAGO-UHFFFAOYSA-N |
| SMILES | C1COCC(N1C(=O)C2=CC(=CN2)Cl)C(=O)O |
Computed by PubChem (NCBI)