CAS 380195-34-6 appears in our catalog under these names: 2-Chloro-n-(4-ethoxy-2-nitrophenyl)acetamide, 95%, 2-Chloro-N-(4-ethoxy-2-nitrophenyl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-N-(4-ethoxy-2-nitrophenyl)acetamide (CAS 380195-34-6) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: 2-chloro-N-(4-ethoxy-2-nitrophenyl)acetamide. InChIKey: PCOMGOJVUYOLJT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | 2-chloro-N-(4-ethoxy-2-nitrophenyl)acetamide |
| InChIKey | PCOMGOJVUYOLJT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)NC(=O)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)