Products 137335-50-3
CAS 137335-50-3 is the registry number for 3-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 137335-50-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 3-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: YQCGMUBYBKDIHK-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 3-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | YQCGMUBYBKDIHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)C34CC(C3)(C4)C(=O)O |
Computed by PubChem (NCBI)