CAS 1373360-92-9 appears in our catalog under these names: b-D-Glucopyranosiduronic Acid Propyl Methyl Ester, 2,3,4-Triacetate, beta-D-Glucopyranosiduronic Acid Propyl Methyl Ester, 2,3,4-Triacetate. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (CAS 1373360-92-9) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol. InChIKey: AIXQQSTVOSFSMO-FFSVYQOJSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| InChIKey | AIXQQSTVOSFSMO-FFSVYQOJSA-N |
| SMILES | COC1=C2C3=C(CNCC[C@]34C=C[C@H](C[C@@H]4O2)O)C=C1 |
Computed by PubChem (NCBI)