CAS 156040-03-8 is the registry number for Epi Norgalanthamine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
(1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (CAS 156040-03-8) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol. InChIKey: AIXQQSTVOSFSMO-FFSVYQOJSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (1S,12S,14S)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| InChIKey | AIXQQSTVOSFSMO-FFSVYQOJSA-N |
| SMILES | COC1=C2C3=C(CNCC[C@]34C=C[C@H](C[C@@H]4O2)O)C=C1 |
Computed by PubChem (NCBI)