CAS 1373625-34-3 appears in our catalog under these names: ARN 077, 99+%, ARN 077, ARN 077, 99.77%, 99.77%, ARN 077, 98.83%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 50 mg, 10mM/1mL, 100 mg.
5-phenylpentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (CAS 1373625-34-3) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 5-phenylpentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate. InChIKey: PTVDTLVLQXSSEC-GXTWGEPZSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 5-phenylpentyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| InChIKey | PTVDTLVLQXSSEC-GXTWGEPZSA-N |
| SMILES | C[C@H]1[C@H](C(=O)O1)NC(=O)OCCCCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)