CAS 13737-35-4 appears in our catalog under these names: 2-(2-(Bromomethyl)phenyl)acetic acid, 98%, Benzeneacetic acid, 2-(bromomethyl)-, 95%, 95%, 2-(BROMOMETHYL)PHENYLACETIC ACID, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
2-[2-(bromomethyl)phenyl]acetic acid (CAS 13737-35-4) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-[2-(bromomethyl)phenyl]acetic acid. InChIKey: OWUUOJBKIIEHTJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-[2-(bromomethyl)phenyl]acetic acid |
| InChIKey | OWUUOJBKIIEHTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)CBr |
Computed by PubChem (NCBI)