Products 1373921-10-8
CAS 1373921-10-8 appears in our catalog under these names: 3-[2-Methyl-5-(trifluoromethoxy)phenyl]propionic acid, 95%, 3-[2-Methyl-5-(trifluoromethoxy)phenyl]propionic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid (CAS 1373921-10-8) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: HRXITAZJWHWLCF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | HRXITAZJWHWLCF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)