CAS 1374144-82-7 is the registry number for (S)-3-(tert-Butyldimethylsilyloxy) piperidine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl-dimethyl-[(3S)-piperidin-3-yl]oxysilane (CAS 1374144-82-7) is a chemical compound with the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. IUPAC name: tert-butyl-dimethyl-[(3S)-piperidin-3-yl]oxysilane. InChIKey: UVNBNPBGKCEBMX-JTQLQIEISA-N.
| Molecular formula | C11H25NOSi |
|---|---|
| Molecular weight | 215.41 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(3S)-piperidin-3-yl]oxysilane |
| InChIKey | UVNBNPBGKCEBMX-JTQLQIEISA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCNC1 |
Computed by PubChem (NCBI)