CAS 1416807-31-2 appears in our catalog under these names: (R)-3-(tert-Butyldimethylsilyloxy) piperidine, 95%, (R)-3-(TERT-BUTYLDIMETHYLSILYLOXY) PIPERIDINE, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl-dimethyl-[(3R)-piperidin-3-yl]oxysilane (CAS 1416807-31-2) is a chemical compound with the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. IUPAC name: tert-butyl-dimethyl-[(3R)-piperidin-3-yl]oxysilane. InChIKey: UVNBNPBGKCEBMX-SNVBAGLBSA-N.
| Molecular formula | C11H25NOSi |
|---|---|
| Molecular weight | 215.41 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(3R)-piperidin-3-yl]oxysilane |
| InChIKey | UVNBNPBGKCEBMX-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCNC1 |
Computed by PubChem (NCBI)