Products 2806011-38-9
CAS 2806011-38-9 is the registry number for (1R,2R)-2-((tert-Butyldimethylsilyl)oxy)cyclopentan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-amine (CAS 2806011-38-9) is a chemical compound with the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. IUPAC name: trans-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-amine. InChIKey: PPOUQWXPSJYBGX-NXEZZACHSA-N.
| Molecular formula | C11H25NOSi |
|---|---|
| Molecular weight | 215.41 g/mol |
| IUPAC name | trans-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-amine |
| InChIKey | PPOUQWXPSJYBGX-NXEZZACHSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@H]1N |
Computed by PubChem (NCBI)