CAS 474774-33-9 is the registry number for (R)-2-(((TERT-BUTYLDIMETHYLSILYL)OXY)METHYL)PYRROLIDINE, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl-dimethyl-[[(2R)-pyrrolidin-2-yl]methoxy]silane (CAS 474774-33-9) is a chemical compound with the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. IUPAC name: tert-butyl-dimethyl-[[(2R)-pyrrolidin-2-yl]methoxy]silane. InChIKey: SCSMCZJZQYDACU-SNVBAGLBSA-N.
| Molecular formula | C11H25NOSi |
|---|---|
| Molecular weight | 215.41 g/mol |
| IUPAC name | tert-butyl-dimethyl-[[(2R)-pyrrolidin-2-yl]methoxy]silane |
| InChIKey | SCSMCZJZQYDACU-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCCN1 |
Computed by PubChem (NCBI)