Products 1374160-25-4
CAS 1374160-25-4 is the registry number for 1-N-Boc-2-nitroethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-(2-nitroethyl)carbamate (CAS 1374160-25-4) is a chemical compound with the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. IUPAC name: tert-butyl N-(2-nitroethyl)carbamate. InChIKey: KDZRVFKODNHSHG-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O4 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | tert-butyl N-(2-nitroethyl)carbamate |
| InChIKey | KDZRVFKODNHSHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[N+](=O)[O-] |
Computed by PubChem (NCBI)