Products 267230-15-9

CAS 267230-15-9 is the registry number for Dimethyl propane-1,3-diyldicarbamate 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl N-[3-(methoxycarbonylamino)propyl]carbamate (CAS 267230-15-9) is a chemical compound with the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. IUPAC name: methyl N-[3-(methoxycarbonylamino)propyl]carbamate. InChIKey: KPPQHGGHTCGGOK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14N2O4
Molecular weight190.20 g/mol
IUPAC namemethyl N-[3-(methoxycarbonylamino)propyl]carbamate
InChIKeyKPPQHGGHTCGGOK-UHFFFAOYSA-N
SMILESCOC(=O)NCCCNC(=O)OC

Computed by PubChem (NCBI)