CAS 2577-62-0 appears in our catalog under these names: (6R,2R)-Diaminopimelic acid, DL–2,6–Diaminopimelic acid, DL-2,6-Diaminopimelic acid, ≥95%, ≥95%. Offered by: Creative Peptides, GLPBio, Chemat. Available pack sizes: on request, 10mg, 5mg.
2,2-diaminoheptanedioic acid (CAS 2577-62-0) is a chemical compound with the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. IUPAC name: 2,2-diaminoheptanedioic acid. InChIKey: HAWJUUUDZFZUKG-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O4 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2,2-diaminoheptanedioic acid |
| InChIKey | HAWJUUUDZFZUKG-UHFFFAOYSA-N |
| SMILES | C(CCC(C(=O)O)(N)N)CC(=O)O |
Computed by PubChem (NCBI)