Products 1485529-87-0
CAS 1485529-87-0 is the registry number for 2,6-Diaminoheptanedioic Acid-13C7. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 1 mg.
2,6-diamino(1,2,3,4,5,6,7-13C7)heptanedioic acid (CAS 1485529-87-0) is a chemical compound with the molecular formula C7H14N2O4 and a molecular weight of 197.15 g/mol. IUPAC name: 2,6-diamino(1,2,3,4,5,6,7-13C7)heptanedioic acid. InChIKey: GMKMEZVLHJARHF-BNUYUSEDSA-N.
| Molecular formula | C7H14N2O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 2,6-diamino(1,2,3,4,5,6,7-13C7)heptanedioic acid |
| InChIKey | GMKMEZVLHJARHF-BNUYUSEDSA-N |
| SMILES | [13CH2]([13CH2][13CH]([13C](=O)O)N)[13CH2][13CH]([13C](=O)O)N |
Computed by PubChem (NCBI)