Products 1374258-59-9
CAS 1374258-59-9 appears in our catalog under these names: 3-(Trifluoromethyl)-1h-indazole-5-carboxylic acid, 95%, 3-(Trifluoromethyl)-1H-indazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 100mg, 500mg.
3-(trifluoromethyl)-2H-indazole-5-carboxylic acid (CAS 1374258-59-9) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-indazole-5-carboxylic acid. InChIKey: FHKPNGNKOMYRKN-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-indazole-5-carboxylic acid |
| InChIKey | FHKPNGNKOMYRKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)