CAS 1374408-30-6 is the registry number for 2-(5-Chloro-1H-1,3-benzodiazol-1-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(5-chlorobenzimidazol-1-yl)ethanamine;dihydrochloride (CAS 1374408-30-6) is a chemical compound with the molecular formula C9H12Cl3N3 and a molecular weight of 268.6 g/mol. IUPAC name: 2-(5-chlorobenzimidazol-1-yl)ethanamine;dihydrochloride. InChIKey: HVFZVMIYKAPAAZ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N3 |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 2-(5-chlorobenzimidazol-1-yl)ethanamine;dihydrochloride |
| InChIKey | HVFZVMIYKAPAAZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=CN2CCN.Cl.Cl |
Computed by PubChem (NCBI)