Products 87394-46-5
CAS 87394-46-5 is the registry number for 1-(3,5-Dichloropyridin-2-yl)piperazine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-dichloro-2-pyridinyl)piperazine;hydrochloride (CAS 87394-46-5) is a chemical compound with the molecular formula C9H12Cl3N3 and a molecular weight of 268.6 g/mol. IUPAC name: 1-(3,5-dichloro-2-pyridinyl)piperazine;hydrochloride. InChIKey: GNRUVVTVHPRNEO-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N3 |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-pyridinyl)piperazine;hydrochloride |
| InChIKey | GNRUVVTVHPRNEO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=N2)Cl)Cl.Cl |
Computed by PubChem (NCBI)