Products 1374433-06-3
CAS 1374433-06-3 appears in our catalog under these names: [1,1':4',1''-Terphenyl]-3,3'',5,5''-tetraamine 98%, [1,1':4',1''-Terphenyl]-3,3'',5,5''-tetraamine, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[4-(3,5-diaminophenyl)phenyl]benzene-1,3-diamine (CAS 1374433-06-3) is a chemical compound with the molecular formula C18H18N4 and a molecular weight of 290.4 g/mol. IUPAC name: 5-[4-(3,5-diaminophenyl)phenyl]benzene-1,3-diamine. InChIKey: NDJJOWVHSZZAJM-UHFFFAOYSA-N.
| Molecular formula | C18H18N4 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 5-[4-(3,5-diaminophenyl)phenyl]benzene-1,3-diamine |
| InChIKey | NDJJOWVHSZZAJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)N)N)C3=CC(=CC(=C3)N)N |
Computed by PubChem (NCBI)