CAS 55778-02-4 appears in our catalog under these names: WZ811/ 99.58% (existing batch purity), WZ811, WZ 811, >97.0%(T), WZ811 99%, WZ811, 99.80%. Offered by: TargetMol, GLPBio, TCI, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]pyridin-2-amine (CAS 55778-02-4) is a chemical compound with the molecular formula C18H18N4 and a molecular weight of 290.4 g/mol. IUPAC name: N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]pyridin-2-amine. InChIKey: KBVFRXIGQQRMEF-UHFFFAOYSA-N.
| Molecular formula | C18H18N4 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N-[[4-[(pyridin-2-ylamino)methyl]phenyl]methyl]pyridin-2-amine |
| InChIKey | KBVFRXIGQQRMEF-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NCC2=CC=C(C=C2)CNC3=CC=CC=N3 |
Computed by PubChem (NCBI)