CAS 380416-23-9 appears in our catalog under these names: N-Methyl-n'-(3-methyl-1-phenyl-1h-pyrazol-5-yl)benzenecarboximidamide, 95%, N-Methyl-N'-(3-methyl-1-phenyl-1H-pyrazol-5-yl)benzenecarboximidamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N'-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide (CAS 380416-23-9) is a chemical compound with the molecular formula C18H18N4 and a molecular weight of 290.4 g/mol. IUPAC name: N'-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide. InChIKey: LJYWZTSETXGNEI-UHFFFAOYSA-N.
| Molecular formula | C18H18N4 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N'-methyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide |
| InChIKey | LJYWZTSETXGNEI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC(=NC)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)