CAS 5981-09-9 appears in our catalog under these names: Tris(p-aminophenyl)amine, Tris(4-aminophenyl)amine, 97% , Tris(4-aminophenyl)amine, >98.0%(HPLC)(T), 4,4',4''-Triaminotriphenylamine 97%, 4,4',4''-Triaminotriphenylamine, 97%, 97%. Offered by: TRC, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 500mg, 5g, 1g, 250mg, 500g, 10g, 25g, 100g.
4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine (CAS 5981-09-9) is a chemical compound with the molecular formula C18H18N4 and a molecular weight of 290.4 g/mol. IUPAC name: 4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine. InChIKey: SNLFYGIUTYKKOE-UHFFFAOYSA-N.
| Molecular formula | C18H18N4 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 4-N,4-N-bis(4-aminophenyl)benzene-1,4-diamine |
| InChIKey | SNLFYGIUTYKKOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)