CAS 1374447-53-6 is the registry number for 3-(4-((phenylamino)phenyl)imino)indolin-2-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-anilinophenyl)imino-1H-indol-2-one (CAS 1374447-53-6) is a chemical compound with the molecular formula C20H15N3O and a molecular weight of 313.4 g/mol. IUPAC name: 3-(4-anilinophenyl)imino-1H-indol-2-one. InChIKey: DESDOYAKQZNPMO-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 3-(4-anilinophenyl)imino-1H-indol-2-one |
| InChIKey | DESDOYAKQZNPMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N=C3C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)