Products 95060-18-7
CAS 95060-18-7 is the registry number for 3-(2,2-Diphenylhydrazono)indolin-2-one, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(3E)-3-(diphenylhydrazinylidene)-1H-indol-2-one (CAS 95060-18-7) is a chemical compound with the molecular formula C20H15N3O and a molecular weight of 313.4 g/mol. IUPAC name: (3E)-3-(diphenylhydrazinylidene)-1H-indol-2-one. InChIKey: YTIARQDLTLPRGG-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (3E)-3-(diphenylhydrazinylidene)-1H-indol-2-one |
| InChIKey | YTIARQDLTLPRGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)/N=C/3\C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)