Products 2460172-77-2
CAS 2460172-77-2 is the registry number for (S)-4-Phenyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg.
(4S)-4-phenyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole (CAS 2460172-77-2) is a chemical compound with the molecular formula C20H15N3O and a molecular weight of 313.4 g/mol. IUPAC name: (4S)-4-phenyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole. InChIKey: SRBCROWEOPFIJY-QGZVFWFLSA-N.
| Molecular formula | C20H15N3O |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (4S)-4-phenyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | SRBCROWEOPFIJY-QGZVFWFLSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC=CC3=C2NC4=CC=CC=C34)C5=CC=CC=C5 |
Computed by PubChem (NCBI)