CAS 851768-63-3 appears in our catalog under these names: 2,3-Dihydro-2-spiro-4'-[8'-aminonaphthalen-1'(4'h)-one]perimidine, 95%, 5–Amino–1',3'–dihydro–4H–spiro(naphthalene–1,2'–perimidin)–4–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg.
8'-aminospiro[1,3-dihydroperimidine-2,4'-naphthalene]-1'-one (CAS 851768-63-3) is a chemical compound with the molecular formula C20H15N3O and a molecular weight of 313.4 g/mol. IUPAC name: 8'-aminospiro[1,3-dihydroperimidine-2,4'-naphthalene]-1'-one. InChIKey: GEUHINMXSZXTFV-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 8'-aminospiro[1,3-dihydroperimidine-2,4'-naphthalene]-1'-one |
| InChIKey | GEUHINMXSZXTFV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC4(C=CC(=O)C5=C4C=CC=C5N)NC3=CC=C2 |
Computed by PubChem (NCBI)