CAS 1374526-35-8 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 1374526-35-8) is a chemical compound with the molecular formula C10H14BNO4S and a molecular weight of 255.10 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: BDSWZQGTTDSPSU-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4S |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | BDSWZQGTTDSPSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)