CAS 913835-83-3 appears in our catalog under these names: (2–(Pyrrolidin–1–ylsulfonyl)phenyl)boronic acid, (2-(Pyrrolidin-1-ylsulfonyl)phenyl)boronic acid, 97%, 97%, (2-(Pyrrolidin-1-ylsulfonyl)phenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g.
(2-pyrrolidin-1-ylsulfonylphenyl)boronic acid (CAS 913835-83-3) is a chemical compound with the molecular formula C10H14BNO4S and a molecular weight of 255.10 g/mol. IUPAC name: (2-pyrrolidin-1-ylsulfonylphenyl)boronic acid. InChIKey: ONRDSHCJDLWHKN-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4S |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | (2-pyrrolidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | ONRDSHCJDLWHKN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)