Products 1929555-36-1
CAS 1929555-36-1 is the registry number for β-Lactamase-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methylsulfanyl-N-[(2R,6S)-8-oxo-9,10-dioxa-1-borabicyclo[4.3.1]dec-4-en-2-yl]acetamide (CAS 1929555-36-1) is a chemical compound with the molecular formula C10H14BNO4S and a molecular weight of 255.10 g/mol. IUPAC name: 2-methylsulfanyl-N-[(2R,6S)-8-oxo-9,10-dioxa-1-borabicyclo[4.3.1]dec-4-en-2-yl]acetamide. InChIKey: XBTPQCVHOOTEFL-SFYZADRCSA-N.
| Molecular formula | C10H14BNO4S |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2-methylsulfanyl-N-[(2R,6S)-8-oxo-9,10-dioxa-1-borabicyclo[4.3.1]dec-4-en-2-yl]acetamide |
| InChIKey | XBTPQCVHOOTEFL-SFYZADRCSA-N |
| SMILES | B12[C@H](CC=C[C@@H](O1)CC(=O)O2)NC(=O)CSC |
Computed by PubChem (NCBI)
Synonyms:
beta-Lactamase-IN-8, orb1689633