CAS 1704095-41-9 is the registry number for (3–(N–Cyclopropylsulfamoyl)– 4–methylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-(cyclopropylsulfamoyl)-4-methylphenyl]boronic acid (CAS 1704095-41-9) is a chemical compound with the molecular formula C10H14BNO4S and a molecular weight of 255.10 g/mol. IUPAC name: [3-(cyclopropylsulfamoyl)-4-methylphenyl]boronic acid. InChIKey: WIVHFBCITVZVNG-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4S |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | [3-(cyclopropylsulfamoyl)-4-methylphenyl]boronic acid |
| InChIKey | WIVHFBCITVZVNG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)S(=O)(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)